EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12O5 |
| Net Charge | 0 |
| Average Mass | 236.223 |
| Monoisotopic Mass | 236.06847 |
| SMILES | C[C@]1(c2ccc(C(=O)O)cc2O)CCC(=O)O1 |
| InChI | InChI=1S/C12H12O5/c1-12(5-4-10(14)17-12)8-3-2-7(11(15)16)6-9(8)13/h2-3,6,13H,4-5H2,1H3,(H,15,16)/t12-/m1/s1 |
| InChIKey | QBZZGMOAQWNCHR-GFCCVEGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (29126957) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-1-hydroxyboivinianic acid (CHEBI:217296) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 3-hydroxy-4-[(2R)-2-methyl-5-oxooxolan-2-yl]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 65323165 | ChemSpider |