EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H41N7O10 |
| Net Charge | 0 |
| Average Mass | 623.664 |
| Monoisotopic Mass | 623.29149 |
| SMILES | CNC(CCCN(O)C(=O)CCNC(=O)[C@H](C)NC(=O)[C@H](N)COC(=O)c1ccccc1O)C(=O)N[C@H]1CCCN(O)C1=O |
| InChI | InChI=1S/C27H41N7O10/c1-16(31-24(38)18(28)15-44-27(41)17-7-3-4-10-21(17)35)23(37)30-12-11-22(36)33(42)13-5-8-19(29-2)25(39)32-20-9-6-14-34(43)26(20)40/h3-4,7,10,16,18-20,29,35,42-43H,5-6,8-9,11-15,28H2,1-2H3,(H,30,37)(H,31,38)(H,32,39)/t16-,18+,19?,20-/m0/s1 |
| InChIKey | KNPIAGSRCKISTI-UVIIYCAGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomadura madurae (ncbitaxon:1993) | - | PubMed (15112961) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Madurastatin A3 (CHEBI:217288) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| [(2R)-2-amino-3-[[(2S)-1-[[3-[hydroxy-[5-[[(3S)-1-hydroxy-2-oxopiperidin-3-yl]amino]-4-(methylamino)-5-oxopentyl]amino]-3-oxopropyl]amino]-1-oxopropan-2-yl]amino]-3-oxopropyl] 2-hydroxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 78438656 | ChemSpider |