EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H15NO6 |
| Net Charge | 0 |
| Average Mass | 281.264 |
| Monoisotopic Mass | 281.08994 |
| SMILES | COC(=O)CCN1Cc2c(O)c(O)c(O)c(C)c2C1=O |
| InChI | InChI=1S/C13H15NO6/c1-6-9-7(11(17)12(18)10(6)16)5-14(13(9)19)4-3-8(15)20-2/h16-18H,3-5H2,1-2H3 |
| InChIKey | BGIAKTACAGZXJN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus flavipes (ncbitaxon:41900) | - | PubMed (29106995) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Azacoccone C (CHEBI:217278) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| methyl 3-(5,6,7-trihydroxy-4-methyl-3-oxo-1H-isoindol-2-yl)propanoate |
| Manual Xrefs | Databases |
|---|---|
| 65323180 | ChemSpider |