EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19NO3 |
| Net Charge | 0 |
| Average Mass | 237.299 |
| Monoisotopic Mass | 237.13649 |
| SMILES | C=C(NC(=O)/C=C/C=C\CC(C)C)C(=O)OC |
| InChI | InChI=1S/C13H19NO3/c1-10(2)8-6-5-7-9-12(15)14-11(3)13(16)17-4/h5-7,9-10H,3,8H2,1-2,4H3,(H,14,15)/b6-5-,9-7+ |
| InChIKey | KJNYYUAWYKCJQS-BZWSEGBZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomium (ncbitaxon:5149) | - | PubMed (24422674) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Corallorazine B (CHEBI:217242) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| methyl 2-[[(2E,4Z)-7-methylocta-2,4-dienoyl]amino]prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 58825868 | ChemSpider |