EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N2O7 |
| Net Charge | 0 |
| Average Mass | 400.387 |
| Monoisotopic Mass | 400.12705 |
| SMILES | O=C(O)c1ccccc1Nc1c(C[C@H](O)[C@H](O)CO)nc2c(C(=O)O)cccc12 |
| InChI | InChI=1S/C20H20N2O7/c23-9-16(25)15(24)8-14-18(21-13-7-2-1-4-10(13)19(26)27)11-5-3-6-12(20(28)29)17(11)22-14/h1-7,15-16,21-25H,8-9H2,(H,26,27)(H,28,29)/t15-,16+/m0/s1 |
| InChIKey | WGZFJGJTOUUWBE-JKSUJKDBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies CMN-62 (ncbitaxon:1527614) | - | PubMed (30106304) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Anthranoside C (CHEBI:217207) is a aminobenzoic acid (CHEBI:22495) |
| IUPAC Name |
|---|
| 3-(2-carboxyanilino)-2-[(2S,3R)-2,3,4-trihydroxybutyl]-1H-indole-7-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 71048533 | ChemSpider |