EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5NO3 |
| Net Charge | 0 |
| Average Mass | 103.077 |
| Monoisotopic Mass | 103.02694 |
| SMILES | [H]C(=O)NCC(=O)O |
| InChI | InChI=1S/C3H5NO3/c5-2-4-1-3(6)7/h2H,1H2,(H,4,5)(H,6,7) |
| InChIKey | UGJBHEZMOKVTIM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (26839171) | ||
| - | MetaboLights (MTBLS298) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formylglycine (CHEBI:21717) is a N-acylglycine (CHEBI:16180) |
| N-formylglycine (CHEBI:21717) is a N-formyl amino acid (CHEBI:50759) |
| IUPAC Name |
|---|
| N-formylglycine |
| Synonyms | Source |
|---|---|
| FGly | ChemIDplus |
| formylglycine | ChemIDplus |
| formamidoacetic acid | IUPAC |
| formylaminoacetic acid | ChEBI |
| Formyl-Gly-OH | ChEBI |
| 2-formamidoacetic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1749108 | Reaxys |
| CAS:2491-15-8 | ChemIDplus |
| Citations |
|---|