EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O7 |
| Net Charge | 0 |
| Average Mass | 408.491 |
| Monoisotopic Mass | 408.21480 |
| SMILES | CCCCCc1cccc(OC)c1C(=O)O[C@@H](C(=O)O[C@@H](C)C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C22H32O7/c1-6-8-9-11-16-12-10-13-17(27-5)18(16)21(25)29-19(14(3)7-2)22(26)28-15(4)20(23)24/h10,12-15,19H,6-9,11H2,1-5H3,(H,23,24)/t14-,15-,19+/m0/s1 |
| InChIKey | TYXOAKSZEQQQPP-YZVOILCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hormoscilla (ncbitaxon:881023) | - | PubMed (32418432) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Anaenoic acid (CHEBI:217138) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| (2S)-2-[(2R,3S)-2-(2-methoxy-6-pentylbenzoyl)oxy-3-methylpentanoyl]oxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 84285763 | ChemSpider |