EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14O9 |
| Net Charge | 0 |
| Average Mass | 398.323 |
| Monoisotopic Mass | 398.06378 |
| SMILES | COC(=O)[C@]1(O)C(=O)c2cccc(O)c2C(=O)[C@]12OC(=O)c1c(C)ccc(O)c12 |
| InChI | InChI=1S/C20H14O9/c1-8-6-7-11(22)14-12(8)17(25)29-20(14)16(24)13-9(4-3-5-10(13)21)15(23)19(20,27)18(26)28-2/h3-7,21-22,27H,1-2H3/t19-,20+/m1/s1 |
| InChIKey | RAAOYZSSJDAIDO-UXHICEINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (32186890) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chartspiroton (CHEBI:217133) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| methyl (1R,2'R)-2',5',7-trihydroxy-4-methyl-1',3,4'-trioxospiro[2-benzouran-1,3'-naphthalene]-2'-carboxylate |