EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O8 |
| Net Charge | 0 |
| Average Mass | 476.566 |
| Monoisotopic Mass | 476.24102 |
| SMILES | C=C1[C@@]2(C)C[C@@H]3[C@](C)(CC=C(C(C)(C)O)[C@@]3(C)CCC(=O)O)[C@]1(C(=O)OC)C(=O)[C@@](C)(O)C2=O |
| InChI | InChI=1S/C26H36O8/c1-14-23(5)13-16-22(4,11-10-17(27)28)15(21(2,3)32)9-12-24(16,6)26(14,20(31)34-8)19(30)25(7,33)18(23)29/h9,16,32-33H,1,10-13H2,2-8H3,(H,27,28)/t16-,22+,23+,24-,25-,26-/m0/s1 |
| InChIKey | CQJRHJLQZVCBIG-GSISZECUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicilliumspecies 6A-9 (ncbitaxon:1586111) | - | DOI (10.1002/ejoc.201701335) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hydroberkeleyone B (CHEBI:217102) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| 3-[(1R,2S,6S,7S,9R,11S)-11-hydroxy-5-(2-hydroxypropan-2-yl)-1-methoxycarbonyl-2,6,9,11-tetramethyl-13-methylidene-10,12-dioxo-6-tricyclo[7.3.1.02,7]tridec-4-enyl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 64808909 | ChemSpider |