EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O6 |
| Net Charge | 0 |
| Average Mass | 322.357 |
| Monoisotopic Mass | 322.14164 |
| SMILES | CC(=O)OCCCCC[C@@H]1Cc2c(C)c(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C17H22O6/c1-10-13-8-12(6-4-3-5-7-22-11(2)18)23-17(21)16(13)15(20)9-14(10)19/h9,12,19-20H,3-8H2,1-2H3/t12-/m1/s1 |
| InChIKey | WNZIMKZOGATFHC-GFCCVEGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cadophora (ncbitaxon:210567) | - | PubMed (26035018) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Soudanone G (CHEBI:217098) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 5-[(3R)-6,8-dihydroxy-5-methyl-1-oxo-3,4-dihydroisochromen-3-yl]pentyl acetate |
| Manual Xrefs | Databases |
|---|---|
| 78440389 | ChemSpider |