EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H43ClN5O8 |
| Net Charge | +1 |
| Average Mass | 781.286 |
| Monoisotopic Mass | 780.27947 |
| SMILES | COC(=O)c1c(-n2ccc(CCNC(=O)[C@H](Cc3ccccc3)NC(=O)[C@H](Cc3ccccc3)[N+](C)(C)C)n2)c(O)cc2oc3cc(C)c(Cl)c(O)c3c(=O)c12 |
| InChI | InChI=1S/C42H42ClN5O8/c1-24-20-31-34(39(51)36(24)43)38(50)33-32(56-31)23-30(49)37(35(33)42(54)55-5)47-19-17-27(46-47)16-18-44-40(52)28(21-25-12-8-6-9-13-25)45-41(53)29(48(2,3)4)22-26-14-10-7-11-15-26/h6-15,17,19-20,23,28-29H,16,18,21-22H2,1-5H3,(H3-,44,45,49,50,51,52,53)/p+1/t28-,29-/m0/s1 |
| InChIKey | MPHIGQSBTKUCRT-VMPREFPWSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (32057246) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Flavipeside B (CHEBI:217086) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| [(2S)-1-[[(2S)-1-[2-[1-(7-chloro-3,8-dihydroxy-1-methoxycarbonyl-6-methyl-9-oxoxanthen-2-yl)pyrazol-3-yl]ethylamino]-1-oxo-3-phenylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-trimethylazanium |