EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O4 |
| Net Charge | 0 |
| Average Mass | 388.548 |
| Monoisotopic Mass | 388.26136 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCc1cc(O)cc(O)c1C(=O)O |
| InChI | InChI=1S/C24H36O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18-21(25)19-22(26)23(20)24(27)28/h6-7,9-10,18-19,25-26H,2-5,8,11-17H2,1H3,(H,27,28)/b7-6-,10-9- |
| InChIKey | UTSVDFSWOSZXBB-HZJYTTRNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hapalopilus mutans (ncbitaxon:114825) | - | DOI (10.1002/(sici)1099-0690(199905)1999:5<1051::aid-ejoc1051>3.0.co;2-9) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dehydromerulinic acid A (CHEBI:217081) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 2-[(8Z,11Z)-heptadeca-8,11-dienyl]-4,6-dihydroxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 10211005 | ChemSpider |