EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O4 |
| Net Charge | 0 |
| Average Mass | 274.316 |
| Monoisotopic Mass | 274.12051 |
| SMILES | C#CC#CC#C/C=C/C[C@@H](O)[C@@H](O)CCCCC(=O)O |
| InChI | InChI=1S/C16H18O4/c1-2-3-4-5-6-7-8-11-14(17)15(18)12-9-10-13-16(19)20/h1,7-8,14-15,17-18H,9-13H2,(H,19,20)/b8-7+/t14-,15+/m1/s1 |
| InChIKey | GEOVOVPJHKMMKC-PEGRTIRESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Collimonas fungivorans Ter331 (ncbitaxon:1005048) | - | PubMed (29792438) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Collimonin C (CHEBI:217064) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (E,6S,7R)-6,7-dihydroxyhexadec-9-en-11,13,15-triynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78439362 | ChemSpider |