EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18O2 |
| Net Charge | 0 |
| Average Mass | 266.340 |
| Monoisotopic Mass | 266.13068 |
| SMILES | C/C=C/C=C/C=C/C=C\c1ccccc1/C=C/C(=O)O |
| InChI | InChI=1S/C18H18O2/c1-2-3-4-5-6-7-8-11-16-12-9-10-13-17(16)14-15-18(19)20/h2-15H,1H3,(H,19,20)/b3-2+,5-4+,7-6+,11-8-,15-14+ |
| InChIKey | ODPDWQHBVRLWMV-WEQBXWHASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (31891272) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Youbetaoufene B2 (CHEBI:217063) is a cinnamic acids (CHEBI:23252) |
| IUPAC Name |
|---|
| (E)-3-[2-[(1Z,3E,5E,7E)-nona-1,3,5,7-tetraenyl]phenyl]prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 81366994 | ChemSpider |