EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H40O4 |
| Net Charge | 0 |
| Average Mass | 536.712 |
| Monoisotopic Mass | 536.29266 |
| SMILES | C/C=C/C=C\C=C\C=C/c1ccccc1[C@@H](CC(=O)O)[C@@H]1C=C/C(=C\CC(=O)O)[C@@H](/C=C\C=C\C=C/C=C/C)C1 |
| InChI | InChI=1S/C36H40O4/c1-3-5-7-9-11-13-15-19-30-20-17-18-22-33(30)34(28-36(39)40)32-24-23-29(25-26-35(37)38)31(27-32)21-16-14-12-10-8-6-4-2/h3-25,31-32,34H,26-28H2,1-2H3,(H,37,38)(H,39,40)/b5-3+,6-4+,9-7-,10-8-,13-11+,14-12+,19-15-,21-16-,29-25+/t31-,32+,34-/m0/s1 |
| InChIKey | PBGNPVWDTRYFBH-GSOXOQHNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (31891272) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Youbetaoufene A1 (CHEBI:217051) is a benzenes (CHEBI:22712) |
| Youbetaoufene A1 (CHEBI:217051) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (3S)-3-[(1S,4E,5R)-4-(2-carboxyethylidene)-5-[(1Z,3E,5Z,7E)-nona-1,3,5,7-tetraenyl]cyclohex-2-en-1-yl]-3-[2-[(1Z,3E,5Z,7E)-nona-1,3,5,7-tetraenyl]phenyl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 81366992 | ChemSpider |