EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O6 |
| Net Charge | 0 |
| Average Mass | 366.454 |
| Monoisotopic Mass | 366.20424 |
| SMILES | C[C@@]1(CO)[C@H](O)CC[C@]2(C)C3=C[C@H]4[C@@H](O)[C@]3(CC[C@@H]12)CC[C@]4(O)C(=O)O |
| InChI | InChI=1S/C20H30O6/c1-17-5-4-14(22)18(2,10-21)12(17)3-6-19-7-8-20(26,16(24)25)11(15(19)23)9-13(17)19/h9,11-12,14-15,21-23,26H,3-8,10H2,1-2H3,(H,24,25)/t11-,12+,14+,15+,17-,18-,19+,20+/m0/s1 |
| InChIKey | BLAFHTJMQHNKOC-ZFEDMJFOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Botrytis cinerea (ncbitaxon:40559) | - | PubMed (31880464) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Botryotin F (CHEBI:217033) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| IUPAC Name |
|---|
| (1R,4R,5R,6R,9S,12S,13R,16R)-6,13,16-trihydroxy-5-(hydroxymethyl)-5,9-dimethyltetracyclo[10.3.1.01,10.04,9]hexadec-10-ene-13-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 81363752 | ChemSpider |