EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20O7 |
| Net Charge | 0 |
| Average Mass | 300.307 |
| Monoisotopic Mass | 300.12090 |
| SMILES | C[C@H](O)[C@H](O)/C=C/C(=O)O[C@@H](C)CCC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C14H20O7/c1-9(3-4-11(16)5-7-13(18)19)21-14(20)8-6-12(17)10(2)15/h5-10,12,15,17H,3-4H2,1-2H3,(H,18,19)/b7-5+,8-6+/t9-,10-,12+/m0/s1 |
| InChIKey | LONPBBGVPRWHEF-VEECKZCXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acaulium (ncbitaxon:1960041) | - | PubMed (29624065) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Acaudiolic acid (CHEBI:217025) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| (E,7S)-7-[(E,4R,5S)-4,5-dihydroxyhex-2-enoyl]oxy-4-oxooct-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78439895 | ChemSpider |