EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2O3 |
| Net Charge | 0 |
| Average Mass | 288.347 |
| Monoisotopic Mass | 288.14739 |
| SMILES | CC[C@@H](C)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H20N2O3/c1-3-10(2)15(19)18-14(16(20)21)8-11-9-17-13-7-5-4-6-12(11)13/h4-7,9-10,14,17H,3,8H2,1-2H3,(H,18,19)(H,20,21)/t10-,14+/m1/s1 |
| InChIKey | HQVGCMKPDWKAJU-YGRLFVJLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium griseofulvum (ncbitaxon:5078) | - | PubMed (29578716) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-N-(2-methylbutanoyl)-L-tryptophan (CHEBI:217003) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2S)-3-(1H-indol-3-yl)-2-[[(2R)-2-methylbutanoyl]amino]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78439359 | ChemSpider |