EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H33NO4 |
| Net Charge | 0 |
| Average Mass | 375.509 |
| Monoisotopic Mass | 375.24096 |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@]23C(=O)C[C@@H](O)CCC[C@H](O)C=C[C@H]2C=C[C@@H](C)[C@@H]13 |
| InChI | InChI=1S/C22H33NO4/c1-13(2)11-18-20-14(3)7-8-15-9-10-16(24)5-4-6-17(25)12-19(26)22(15,20)21(27)23-18/h7-10,13-18,20,24-25H,4-6,11-12H2,1-3H3,(H,23,27)/t14-,15-,16+,17+,18+,20+,22-/m1/s1 |
| InChIKey | XBCWIGDRZOIINM-ODCGGSMJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phomopsis (ncbitaxon:34399) | - | DOI (10.1016/j.tet.2020.131475) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phomopsisin C (CHEBI:216979) has role fungal metabolite (CHEBI:76946) |
| Phomopsisin C (CHEBI:216979) is a cytochalasin (CHEBI:23528) |
| IUPAC Name |
|---|
| (1S,4S,8S,11R,14R,15R,16S)-4,8-dihydroxy-14-methyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,18-dione |