EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O5 |
| Net Charge | 0 |
| Average Mass | 238.239 |
| Monoisotopic Mass | 238.08412 |
| SMILES | Cc1c(O)c(C)c2c(c1O)C(=O)O[C@](C)(O)C2 |
| InChI | InChI=1S/C12H14O5/c1-5-7-4-12(3,16)17-11(15)8(7)10(14)6(2)9(5)13/h13-14,16H,4H2,1-3H3/t12-/m0/s1 |
| InChIKey | GWCJDGBOQAPHGT-LBPRGKRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium citrinum (ncbitaxon:5077) | - | DOI (10.1080/00021369.1968.10859243) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sclerotinin B (CHEBI:216969) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 3,6,8-trihydroxy-3,5,7-trimethyl-4H-isochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 23340871 | ChemSpider |