EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O5 |
| Net Charge | 0 |
| Average Mass | 352.386 |
| Monoisotopic Mass | 352.13107 |
| SMILES | CO[C@H]1CC[C@@H]2c3c(ccc(O)c31)[C@@]1(O)c3cccc(O)c3C(=O)C[C@@H]21 |
| InChI | InChI=1S/C21H20O5/c1-26-17-8-5-10-13-9-16(24)19-11(3-2-4-14(19)22)21(13,25)12-6-7-15(23)20(17)18(10)12/h2-4,6-7,10,13,17,22-23,25H,5,8-9H2,1H3/t10-,13-,17-,21-/m0/s1 |
| InChIKey | KILVFQPOBUNVMF-PQYYAGPLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypoxylon (ncbitaxon:42308) | - | PubMed (17253861) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Daldinone D (CHEBI:216915) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| (2R,11S,12S,15S)-2,7,17-trihydroxy-15-methoxypentacyclo[10.7.1.02,11.03,8.016,20]icosa-1(20),3(8),4,6,16,18-hexaen-9-one |
| Manual Xrefs | Databases |
|---|---|
| 17262758 | ChemSpider |