EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32O3 |
| Net Charge | 0 |
| Average Mass | 356.506 |
| Monoisotopic Mass | 356.23514 |
| SMILES | CC(=O)[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3C[C@H](O)[C@]12C |
| InChI | InChI=1S/C23H32O3/c1-13(14(2)24)18-7-8-19-17-6-5-15-11-16(25)9-10-22(15,3)20(17)12-21(26)23(18,19)4/h9-11,13,17-21,26H,5-8,12H2,1-4H3/t13-,17+,18-,19+,20+,21+,22+,23-/m1/s1 |
| InChIKey | ADAGZDQSLWVWDS-OZNMWJIMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gordonia (ncbitaxon:2053) | - | PubMed (18667783) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bendigole B (CHEBI:216905) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (8R,9S,10R,12S,13S,14S,17R)-12-hydroxy-10,13-dimethyl-17-[(2S)-3-oxobutan-2-yl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| Manual Xrefs | Databases |
|---|---|
| 78441352 | ChemSpider |