EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O5 |
| Net Charge | 0 |
| Average Mass | 266.293 |
| Monoisotopic Mass | 266.11542 |
| SMILES | C[C@H]1OC(=O)c2c(O)cc(O)cc2CCCC[C@@H]1O |
| InChI | InChI=1S/C14H18O5/c1-8-11(16)5-3-2-4-9-6-10(15)7-12(17)13(9)14(18)19-8/h6-8,11,15-17H,2-5H2,1H3/t8-,11+/m1/s1 |
| InChIKey | WKFFXXWAWNQFDJ-KCJUWKMLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetosphaeronema hispidulum (ncbitaxon:565418) | - | PubMed (30095908) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hispidulactone B (CHEBI:216890) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R,4S)-4,10,12-trihydroxy-3-methyl-3,4,5,6,7,8-hexahydro-2-benzoxecin-1-one |