EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O5 |
| Net Charge | 0 |
| Average Mass | 332.396 |
| Monoisotopic Mass | 332.16237 |
| SMILES | C/C(=C/CC(=O)O)CCC/C(C)=C/Cc1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C19H24O5/c1-13(4-3-5-14(2)7-11-18(21)22)6-8-15-12-16(19(23)24)9-10-17(15)20/h6-7,9-10,12,20H,3-5,8,11H2,1-2H3,(H,21,22)(H,23,24)/b13-6+,14-7- |
| InChIKey | JJTONVAWZIGUCY-JFCLYLFASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Erythrobacterspecies (ncbitaxon:1042) | - | PubMed (22384985) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Erythrolic acid D (CHEBI:216874) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 3-[(2E,7Z)-9-carboxy-3,7-dimethylnona-2,7-dienyl]-4-hydroxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 29214673 | ChemSpider |