EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H62N6O5 |
| Net Charge | 0 |
| Average Mass | 658.929 |
| Monoisotopic Mass | 658.47817 |
| SMILES | CN[C@H](C(=O)N[C@H](C(=O)N(C)[C@H](C(=O)N(C)[C@H](C(=O)N[C@H](C(=O)NCCc1ccccc1)C(C)C)C(C)C)C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C36H62N6O5/c1-21(2)27(37-11)33(44)40-29(23(5)6)35(46)42(13)31(25(9)10)36(47)41(12)30(24(7)8)34(45)39-28(22(3)4)32(43)38-20-19-26-17-15-14-16-18-26/h14-18,21-25,27-31,37H,19-20H2,1-13H3,(H,38,43)(H,39,45)(H,40,44)/t27-,28-,29-,30-,31-/m0/s1 |
| InChIKey | KHNZOSFWTNJIOM-QKUYTOGTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus (ncbitaxon:626) | - | PubMed (29597344) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rhabdopeptide M (CHEBI:216819) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-3-methyl-2-(methylamino)-N-[(2S)-3-methyl-1-[methyl-[(2S)-3-methyl-1-[methyl-[(2S)-3-methyl-1-[[(2S)-3-methyl-1-oxo-1-(2-phenylethylamino)butan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]butanamide |