EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H65N7O5 |
| Net Charge | 0 |
| Average Mass | 711.993 |
| Monoisotopic Mass | 711.50472 |
| SMILES | CN[C@H](C(=O)N[C@H](C(=O)N(C)[C@H](C(=O)N(C)[C@H](C(=O)N(C)[C@H](C(=O)NCCc1cnc2ccccc12)C(C)C)C(C)C)C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C39H65N7O5/c1-22(2)30(40-11)35(47)43-31(23(3)4)37(49)45(13)33(25(7)8)39(51)46(14)34(26(9)10)38(50)44(12)32(24(5)6)36(48)41-20-19-27-21-42-29-18-16-15-17-28(27)29/h15-18,21-26,30-34,40,42H,19-20H2,1-14H3,(H,41,48)(H,43,47)/t30-,31-,32-,33-,34-/m0/s1 |
| InChIKey | OVPJHKWQAPWZMB-LJADHVKFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus (ncbitaxon:626) | - | PubMed (29597344) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rhabdopeptide J (CHEBI:216807) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-N-[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[2-(1H-indol-3-yl)ethylamino]-3-methyl-1-oxobutan-2-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(methylamino)butanamide |