EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H54N6O4 |
| Net Charge | 0 |
| Average Mass | 598.833 |
| Monoisotopic Mass | 598.42065 |
| SMILES | CN[C@H](C(=O)N[C@H](C(=O)N(C)[C@H](C(=O)N(C)[C@H](C(=O)NCCc1cnc2ccccc12)C(C)C)C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C33H54N6O4/c1-19(2)26(34-9)30(40)37-27(20(3)4)32(42)39(11)29(22(7)8)33(43)38(10)28(21(5)6)31(41)35-17-16-23-18-36-25-15-13-12-14-24(23)25/h12-15,18-22,26-29,34,36H,16-17H2,1-11H3,(H,35,41)(H,37,40)/t26-,27-,28-,29-/m0/s1 |
| InChIKey | PRSLJVZAOGJMJE-DZUOILHNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus (ncbitaxon:626) | - | PubMed (29597344) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rhabdopeptide I (CHEBI:216801) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-N-[(2S)-1-[[(2S)-1-[[(2S)-1-[2-(1H-indol-3-yl)ethylamino]-3-methyl-1-oxobutan-2-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(methylamino)butanamide |