EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NO4 |
| Net Charge | 0 |
| Average Mass | 327.380 |
| Monoisotopic Mass | 327.14706 |
| SMILES | [H][C@@]12C=C[C@H](OC(C)=O)[C@@H]3Oc4c(O)ccc5c4[C@@]31CCN(C)[C@@H]2C5 |
| InChI | InChI=1S/C19H21NO4/c1-10(21)23-15-6-4-12-13-9-11-3-5-14(22)17-16(11)19(12,18(15)24-17)7-8-20(13)2/h3-6,12-13,15,18,22H,7-9H2,1-2H3/t12-,13+,15-,18-,19-/m0/s1 |
| InChIKey | JJGYGPZNTOPXGV-SSTWWWIQSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-acetylmorphine (CHEBI:2168) has functional parent morphine (CHEBI:17303) |
| 6-acetylmorphine (CHEBI:2168) has role drug metabolite (CHEBI:49103) |
| 6-acetylmorphine (CHEBI:2168) is a acetate ester (CHEBI:47622) |
| 6-acetylmorphine (CHEBI:2168) is a morphinane alkaloid (CHEBI:25418) |
| 6-acetylmorphine (CHEBI:2168) is a organic heteropentacyclic compound (CHEBI:38164) |
| 6-acetylmorphine (CHEBI:2168) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 3-hydroxy-17-methyl-5α-7,8-didehydro-4,5-epoxymorphinan-6α-yl acetate |
| Synonyms | Source |
|---|---|
| 6-AM | ChEBI |
| 6-O-acetylmorphine | ChEBI |
| 6-O-monoacetylmorphine | KEGG COMPOUND |
| 6-MAM | ChEBI |
| 6-monoacetylmorphine | ChEBI |
| O6-acetylmorphine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 6-Monoacetylmorphine | Wikipedia |
| C11781 | KEGG COMPOUND |
| HMDB0041812 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:2784-73-8 | NIST Chemistry WebBook |
| Citations |
|---|