EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:216783 - Lepiotaprocerin F
| Formula | C32H42O6 |
| Net Charge | 0 |
| Average Mass | 522.682 |
| Monoisotopic Mass | 522.29814 |
| SMILES | CC(=O)O[C@H]1C[C@@]2(C)C3=C4[C@@H](C[C@]2(C)[C@H]1[C@H](C)C[C@@H]1C=C(C)C(=O)O1)OC1=CC(=O)C(C)(C)[C@H](CC3)[C@]14C |
| InChI | InChI=1S/C32H42O6/c1-16(11-19-12-17(2)28(35)37-19)26-21(36-18(3)33)14-30(6)20-9-10-23-29(4,5)24(34)13-25-32(23,8)27(20)22(38-25)15-31(26,30)7/h12-13,16,19,21-23,26H,9-11,14-15H2,1-8H3/t16-,19-,21+,22-,23+,26+,30+,31-,32-/m1/s1 |
| InChIKey | NVPYGXLXWVWRLY-SWMXMBRNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macrolepiota procera (ncbitaxon:56183) | - | PubMed (29510036) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lepiotaprocerin F (CHEBI:216783) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| [(1R,3R,4R,5S,7R,11R,16S)-3,7,12,12,16-pentamethyl-4-[(2R)-1-[(2R)-4-methyl-5-oxo-2H-uran-2-yl]propan-2-yl]-13-oxo-18-oxapentacyclo[13.2.1.03,7.08,17.011,16]octadeca-8(17),14-dien-5-yl] acetate |