EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H42O6 |
| Net Charge | 0 |
| Average Mass | 522.682 |
| Monoisotopic Mass | 522.29814 |
| SMILES | CC(=O)O[C@H]1C[C@@]2(C)C3=C(C(=O)C[C@]2(C)[C@H]1[C@H](C)C[C@H]1C=C(C)C(=O)O1)[C@@]1(C)C=CC(=O)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C32H42O6/c1-17(13-20-14-18(2)28(36)38-20)26-23(37-19(3)33)16-31(7)21-9-10-24-29(4,5)25(35)11-12-30(24,6)27(21)22(34)15-32(26,31)8/h11-12,14,17,20,23-24,26H,9-10,13,15-16H2,1-8H3/t17-,20+,23+,24+,26+,30+,31+,32-/m1/s1 |
| InChIKey | FCOHRICIHWBLBL-IHBQTOFZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macrolepiota procera (ncbitaxon:56183) | - | PubMed (29510036) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lepiotaprocerin K (CHEBI:216743) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| [(5R,10S,13R,14R,16S,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-1-[(2S)-4-methyl-5-oxo-2H-uran-2-yl]propan-2-yl]-3,11-dioxo-6,7,12,15,16,17-hexahydro-5H-cyclopenta[a]phenanthren-16-yl] acetate |