EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O8 |
| Net Charge | 0 |
| Average Mass | 400.383 |
| Monoisotopic Mass | 400.11582 |
| SMILES | COc1cc(-c2cc(C(=O)O)cc3cc(OC)c(O)c(OC)c23)cc(OC)c1O |
| InChI | InChI=1S/C21H20O8/c1-26-14-7-10(8-15(27-2)18(14)22)13-6-12(21(24)25)5-11-9-16(28-3)19(23)20(29-4)17(11)13/h5-9,22-23H,1-4H3,(H,24,25) |
| InChIKey | BWPZSCVLKKZAER-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Roseobacterspecies (ncbitaxon:1907202) | - | PubMed (28920692) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Roseochelin A (CHEBI:216687) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| 6-hydroxy-4-(4-hydroxy-3,5-dimethoxyphenyl)-5,7-dimethoxynaphthalene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 62285708 | ChemSpider |