EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H43N7O6 |
| Net Charge | 0 |
| Average Mass | 597.717 |
| Monoisotopic Mass | 597.32748 |
| SMILES | CC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)NC(Cc1ccccc1)C(=O)O)C(=O)NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C30H43N7O6/c1-19(2)25(27(40)34-22(18-38)16-20-10-5-3-6-11-20)37-26(39)23(14-9-15-33-29(31)32)35-30(43)36-24(28(41)42)17-21-12-7-4-8-13-21/h3-8,10-13,19,22-25,38H,9,14-18H2,1-2H3,(H,34,40)(H,37,39)(H,41,42)(H4,31,32,33)(H2,35,36,43) |
| InChIKey | FWFRRBPYKRBFLL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces chromofuscus (ncbitaxon:42881) | - | PubMed (8244894) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mer-N5075-A (CHEBI:216662) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[[5-(diaminomethylideneamino)-1-[[1-[(1-hydroxy-3-phenylpropan-2-yl)amino]-3-methyl-1-oxobutan-2-yl]amino]-1-oxopentan-2-yl]carbamoylamino]-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8636580 | ChemSpider |