EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H18O8 |
| Net Charge | 0 |
| Average Mass | 422.389 |
| Monoisotopic Mass | 422.10017 |
| SMILES | CC(=O)/C(=C\c1ccc(O)c(O)c1)c1c(O)cc(/C=C/c2ccc(O)c(O)c2)oc1=O |
| InChI | InChI=1S/C23H18O8/c1-12(24)16(8-14-4-7-18(26)20(28)10-14)22-21(29)11-15(31-23(22)30)5-2-13-3-6-17(25)19(27)9-13/h2-11,25-29H,1H3/b5-2+,16-8+ |
| InChIKey | DLJCBBHVLOHCCV-DVTHBBLZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phellinus xeranticus (ncbitaxon:1143127) | - | PubMed (17387019) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Interfungin B (CHEBI:216640) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-3-[(Z)-1-(3,4-dihydroxyphenyl)-3-oxobut-1-en-2-yl]-4-hydroxypyran-2-one |
| Manual Xrefs | Databases |
|---|---|
| 23283929 | ChemSpider |