EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21Cl2N3O9 |
| Net Charge | 0 |
| Average Mass | 494.284 |
| Monoisotopic Mass | 493.06548 |
| SMILES | NC(C(=O)O)C(O)C1(C(=O)O)CCC(CC(NC(=O)c2cc(Cl)c(O)c(Cl)c2)C(=O)O)N1 |
| InChI | InChI=1S/C18H21Cl2N3O9/c19-8-3-6(4-9(20)12(8)24)14(26)22-10(15(27)28)5-7-1-2-18(23-7,17(31)32)13(25)11(21)16(29)30/h3-4,7,10-11,13,23-25H,1-2,5,21H2,(H,22,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | AJQRDRIPQOAJCM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium shearii (ncbitaxon:904690) | - | DOI (10.1016/s0040-4039(97)01653-5) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Kaitocephalin (CHEBI:216599) has functional parent N-benzoylglycine (CHEBI:18089) |
| Kaitocephalin (CHEBI:216599) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| 2-(2-amino-2-carboxy-1-hydroxyethyl)-5-[2-carboxy-2-[(3,5-dichloro-4-hydroxybenzoyl)amino]ethyl]pyrrolidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 7981524 | ChemSpider |