EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H54N8O8 |
| Net Charge | 0 |
| Average Mass | 762.909 |
| Monoisotopic Mass | 762.40646 |
| SMILES | CC(C)[C@H]1NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](C(C)C)NC(=O)[C@@H](C)NC(=O)CCCNC(=O)C(CC(=O)c2ccccc2N)NC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C39H54N8O8/c1-21(2)32-38(54)43-24(6)34(50)44-29(20-30(48)26-15-10-11-16-27(26)40)36(52)41-18-12-17-31(49)42-23(5)35(51)46-33(22(3)4)39(55)45-28(37(53)47-32)19-25-13-8-7-9-14-25/h7-11,13-16,21-24,28-29,32-33H,12,17-20,40H2,1-6H3,(H,41,52)(H,42,49)(H,43,54)(H,44,50)(H,45,55)(H,46,51)(H,47,53)/t23-,24-,28+,29?,32-,33-/m1/s1 |
| InChIKey | UWAZAJWYJQHXPD-NTVGNOJHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | DOI (10.1016/j.tetlet.2020.152322) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Unguisin G (CHEBI:216556) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (6R,9R,12S,15R,18R)-3-[2-(2-aminophenyl)-2-oxoethyl]-12-benzyl-6,18-dimethyl-9,15-di(propan-2-yl)-1,4,7,10,13,16,19-heptazacyclotricosane-2,5,8,11,14,17,20-heptone |
| Manual Xrefs | Databases |
|---|---|
| 101936371 | ChemSpider |