EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O3 |
| Net Charge | 0 |
| Average Mass | 250.338 |
| Monoisotopic Mass | 250.15689 |
| SMILES | C=C1CCCC(C)(C)[C@H]1[C@H]1O[C@@H]1C(C)=CC(=O)O |
| InChI | InChI=1S/C15H22O3/c1-9-6-5-7-15(3,4)12(9)14-13(18-14)10(2)8-11(16)17/h8,12-14H,1,5-7H2,2-4H3,(H,16,17)/t12-,13-,14-/m1/s1 |
| InChIKey | WXSWBWVLEUINTC-MGPQQGTHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tropicoporus linteus (ncbitaxon:1659895) | - | PubMed (30002357) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phellinulin D (CHEBI:216532) is a epoxy fatty acid (CHEBI:61498) |
| IUPAC Name |
|---|
| 3-[(2R,3R)-3-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]oxiran-2-yl]but-2-enoic acid |