EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11NO3 |
| Net Charge | 0 |
| Average Mass | 157.169 |
| Monoisotopic Mass | 157.07389 |
| SMILES | CC(=O)N[C@H]1C(=O)OC[C@H]1C |
| InChI | InChI=1S/C7H11NO3/c1-4-3-11-7(10)6(4)8-5(2)9/h4,6H,3H2,1-2H3,(H,8,9)/t4-,6-/m1/s1 |
| InChIKey | ABNUGWRZSYVEEW-INEUFUBQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | DOI (10.1021/np990507r) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Acetyl-g-hydroxyvaline lactone (CHEBI:216529) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| N-[(3R,4S)-4-methyl-2-oxooxolan-3-yl]acetamide |
| Manual Xrefs | Databases |
|---|---|
| 8924768 | ChemSpider |