EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H48N4O8 |
| Net Charge | 0 |
| Average Mass | 580.723 |
| Monoisotopic Mass | 580.34721 |
| SMILES | CCCCCCC[C@@H](N)[C@H](O)C(=O)N[C@@H](CO)C(=O)N(C)[C@H](C(=O)N[C@@H](CCc1ccc(O)cc1)C(=O)O)C(C)C |
| InChI | InChI=1S/C29H48N4O8/c1-5-6-7-8-9-10-21(30)25(36)27(38)32-23(17-34)28(39)33(4)24(18(2)3)26(37)31-22(29(40)41)16-13-19-11-14-20(35)15-12-19/h11-12,14-15,18,21-25,34-36H,5-10,13,16-17,30H2,1-4H3,(H,31,37)(H,32,38)(H,40,41)/t21-,22+,23+,24+,25+/m1/s1 |
| InChIKey | FAFNVISAZDFOJC-RYWAYVEBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Planktothrix agardhii (ncbitaxon:1160) | - | DOI (10.1016/s0031-9422(96)00767-4) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oscillaginin B (CHEBI:216480) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3R)-3-amino-2-hydroxydecanoyl]amino]-3-hydroxypropanoyl]-methylamino]-3-methylbutanoyl]amino]-4-(4-hydroxyphenyl)butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 34516449 | ChemSpider |