EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O7 |
| Net Charge | 0 |
| Average Mass | 334.324 |
| Monoisotopic Mass | 334.10525 |
| SMILES | COc1cc(OC)c2c(c1OC)C(=O)C1=C(CO[C@@](C)(O)C1)C2=O |
| InChI | InChI=1S/C17H18O7/c1-17(20)6-8-9(7-24-17)15(19)12-10(21-2)5-11(22-3)16(23-4)13(12)14(8)18/h5,20H,6-7H2,1-4H3/t17-/m1/s1 |
| InChIKey | QJFGIAWXGDRTCJ-QGZVFWFLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clarireediaspecies CEC-2020a (ncbitaxon:2760841) | - | PubMed (30012966) |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-O-methylfusarubin (CHEBI:216467) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| (3R)-3-hydroxy-6,7,9-trimethoxy-3-methyl-1,4-dihydrobenzo[g]isochromene-5,10-dione |