EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H59NO5 |
| Net Charge | 0 |
| Average Mass | 633.914 |
| Monoisotopic Mass | 633.43932 |
| SMILES | C=C1CC[C@@]2(C=C(N(C)[C@@H](Cc3ccc(O)cc3)[C@H](O)CCC=C[C@H](C)C[C@H](C)CC)C(=O)O2)C[C@@H]1[C@@H](C)C(=O)CCC=C(C)C |
| InChI | InChI=1S/C40H59NO5/c1-9-28(4)23-29(5)14-10-11-15-38(44)35(24-32-17-19-33(42)20-18-32)41(8)36-26-40(46-39(36)45)22-21-30(6)34(25-40)31(7)37(43)16-12-13-27(2)3/h10,13-14,17-20,26,28-29,31,34-35,38,42,44H,6,9,11-12,15-16,21-25H2,1-5,7-8H3/t28-,29+,31-,34+,35+,38-,40+/m1/s1 |
| InChIKey | VIDGNJPCBMOYMK-LAXULLLHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudallescheria (ncbitaxon:5596) | - | PubMed (28708403) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pseudallicin C (CHEBI:216463) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| (5S,7R)-3-[[(2S,3R,8R,10R)-3-hydroxy-1-(4-hydroxyphenyl)-8,10-dimethyldodec-6-en-2-yl]-methylamino]-8-methylidene-7-[(2R)-7-methyl-3-oxooct-6-en-2-yl]-1-oxaspiro[4.5]dec-3-en-2-one |
| Manual Xrefs | Databases |
|---|---|
| 78439317 | ChemSpider |