EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H63N3O9 |
| Net Charge | 0 |
| Average Mass | 681.912 |
| Monoisotopic Mass | 681.45643 |
| SMILES | CCC(C)[C@H]1C(=O)O[C@H](C(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)O[C@H](C(C)C)C(=O)N(C)[C@@H](C(C)CC)C(=O)O[C@H](C(C)C)C(=O)N1C |
| InChI | InChI=1S/C36H63N3O9/c1-16-23(11)26-35(44)47-28(20(5)6)31(40)37(13)25(18-19(3)4)34(43)46-29(21(7)8)32(41)38(14)27(24(12)17-2)36(45)48-30(22(9)10)33(42)39(26)15/h19-30H,16-18H2,1-15H3/t23?,24?,25-,26-,27-,28+,29+,30+/m0/s1 |
| InChIKey | VMUDDRIYPOJBCX-NVNMXTJUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium (ncbitaxon:5506) | - | DOI (10.1139/v92-165) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Enniatin A2 (CHEBI:216436) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3S,6R,9S,12R,15S,18R)-3,9-di(butan-2-yl)-4,10,16-trimethyl-15-(2-methylpropyl)-6,12,18-tri(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
| Manual Xrefs | Databases |
|---|---|
| 8253836 | ChemSpider |