EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H55N7O9 |
| Net Charge | 0 |
| Average Mass | 717.865 |
| Monoisotopic Mass | 717.40613 |
| SMILES | CC[C@H](C)[C@H]1NC(=O)[C@H](Cc2ccc(O)cc2)N(C)C(=O)[C@@H](C)N(C)C(=O)[C@H](C)NC(=O)CN(O)C(=O)[C@@H](CC(C)C)N(C)C(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C35H55N7O9/c1-11-20(4)29-31(46)37-22(6)33(48)41(10)27(16-19(2)3)35(50)42(51)18-28(44)36-21(5)32(47)39(8)23(7)34(49)40(9)26(30(45)38-29)17-24-12-14-25(43)15-13-24/h12-15,19-23,26-27,29,43,51H,11,16-18H2,1-10H3,(H,36,44)(H,37,46)(H,38,45)/t20-,21-,22+,23+,26-,27+,29+/m0/s1 |
| InChIKey | MIULAJWYSPXXSE-VELXIEJISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces (ncbitaxon:5094) | - | PubMed (28383269) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Talarolide A (CHEBI:216432) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (3R,6R,9R,12S,15R,18S)-9-[(2S)-butan-2-yl]-1-hydroxy-12-[(4-hydroxyphenyl)methyl]-4,6,13,15,16,18-hexamethyl-3-(2-methylpropyl)-1,4,7,10,13,16,19-heptazacyclohenicosane-2,5,8,11,14,17,20-heptone |
| Manual Xrefs | Databases |
|---|---|
| 61708472 | ChemSpider |