EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42O7 |
| Net Charge | 0 |
| Average Mass | 514.659 |
| Monoisotopic Mass | 514.29305 |
| SMILES | C[C@@H]1C[C@]2(C[C@@H](C)[C@]3(C[C@H](O)[C@@]4(C)C5=C(C(=O)C[C@]34C)[C@@]3(C)CC[C@H](O)C(C)(C)[C@@H]3CC5=O)O2)OC1=O |
| InChI | InChI=1S/C30H42O7/c1-15-11-29(36-24(15)35)12-16(2)30(37-29)14-21(34)28(7)23-17(31)10-19-25(3,4)20(33)8-9-26(19,5)22(23)18(32)13-27(28,30)6/h15-16,19-21,33-34H,8-14H2,1-7H3/t15-,16-,19+,20+,21+,26+,27+,28+,29+,30+/m1/s1 |
| InChIKey | GHTXJUWCAZBSKK-BZDHVDRSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma resinaceum (ncbitaxon:34465) | - | PubMed (29890656) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (17S,23S)-17,23-epoxy-3beta,15alpha-dihydroxy-7,11-dioxo-5alpha-lanosta-8-en-26,23-olide (CHEBI:216429) is a withanolide (CHEBI:74716) |