EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44O6 |
| Net Charge | 0 |
| Average Mass | 500.676 |
| Monoisotopic Mass | 500.31379 |
| SMILES | C[C@@H]1C[C@]2(C[C@@H](C)[C@]3(C[C@H](O)[C@@]4(C)C5=C(C(=O)C[C@]34C)[C@@]3(C)CC[C@H](O)C(C)(C)[C@@H]3CC5)O2)OC1=O |
| InChI | InChI=1S/C30H44O6/c1-16-12-29(35-24(16)34)13-17(2)30(36-29)15-22(33)28(7)18-8-9-20-25(3,4)21(32)10-11-26(20,5)23(18)19(31)14-27(28,30)6/h16-17,20-22,32-33H,8-15H2,1-7H3/t16-,17-,20+,21+,22+,26+,27+,28-,29+,30+/m1/s1 |
| InChIKey | LRUBMNONCXXESU-XMIHSAFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma resinaceum (ncbitaxon:34465) | - | PubMed (29890656) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (17S,23S)-17,23-epoxy-3beta,15alpha-dihydroxy-11-oxo-5alpha-lanosta-8-en-26,23-olide (CHEBI:216424) is a withanolide (CHEBI:74716) |