EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17NO3 |
| Net Charge | 0 |
| Average Mass | 271.316 |
| Monoisotopic Mass | 271.12084 |
| SMILES | COc1c2c(c(C(=O)O)c3ccncc13)CC(C)(C)C2 |
| InChI | InChI=1S/C16H17NO3/c1-16(2)6-10-11(7-16)14(20-3)12-8-17-5-4-9(12)13(10)15(18)19/h4-5,8H,6-7H2,1-3H3,(H,18,19) |
| InChIKey | FSBVQCVHOXXMGN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clitocybe (ncbitaxon:50966) | - | PubMed (5768225) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Illudinine (CHEBI:216417) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 9-methoxy-7,7-dimethyl-6,8-dihydrocyclopenta[g]isoquinoline-5-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 248322 | ChemSpider |