EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29NO3 |
| Net Charge | 0 |
| Average Mass | 307.434 |
| Monoisotopic Mass | 307.21474 |
| SMILES | CCC[C@H]1C[C@@H]1/C=C/C(=O)O[C@H]1[C@H](CC(C)C)NC(=O)[C@@H]1C |
| InChI | InChI=1S/C18H29NO3/c1-5-6-13-10-14(13)7-8-16(20)22-17-12(4)18(21)19-15(17)9-11(2)3/h7-8,11-15,17H,5-6,9-10H2,1-4H3,(H,19,21)/b8-7+/t12-,13+,14+,15+,17-/m1/s1 |
| InChIKey | BBMBCHAXOBFQPC-IBGZMIKNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oscillatoriaspecies (ncbitaxon:1159) | - | PubMed (28145721) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hoshinolactam (CHEBI:216354) is a carbocyclic fatty acid (CHEBI:35744) |
| IUPAC Name |
|---|
| [(2S,3R,4R)-4-methyl-2-(2-methylpropyl)-5-oxopyrrolidin-3-yl] (E)-3-[(1S,2S)-2-propylcyclopropyl]prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 61360275 | ChemSpider |