EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13N3O5S |
| Net Charge | 0 |
| Average Mass | 359.363 |
| Monoisotopic Mass | 359.05759 |
| SMILES | O=C(O)CNC(=O)C1=NC(C(=O)O)=C(c2cnc3ccccc23)SC1 |
| InChI | InChI=1S/C16H13N3O5S/c20-12(21)6-18-15(22)11-7-25-14(13(19-11)16(23)24)9-5-17-10-4-2-1-3-8(9)10/h1-5,17H,6-7H2,(H,18,22)(H,20,21)(H,23,24) |
| InChIKey | FMIXORNQONFTAM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (32243812) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Indolokine A8 (CHEBI:216319) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 3-(carboxymethylcarbamoyl)-6-(1H-indol-3-yl)-2H-1,4-thiazine-5-carboxylic acid |