EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13N3O4S |
| Net Charge | 0 |
| Average Mass | 331.353 |
| Monoisotopic Mass | 331.06268 |
| SMILES | O=C(O)CNC(=O)[C@@H]1CSC(C(=O)c2cnc3ccccc23)=N1 |
| InChI | InChI=1S/C15H13N3O4S/c19-12(20)6-17-14(22)11-7-23-15(18-11)13(21)9-5-16-10-4-2-1-3-8(9)10/h1-5,11,16H,6-7H2,(H,17,22)(H,19,20)/t11-/m0/s1 |
| InChIKey | OANJKHJZNRTUCW-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (32243812) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Indolokine A2 (CHEBI:216301) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[[(4R)-2-(1H-indole-3-carbonyl)-4,5-dihydro-1,3-thiazole-4-carbonyl]amino]acetic acid |