EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8N2O3S |
| Net Charge | 0 |
| Average Mass | 272.285 |
| Monoisotopic Mass | 272.02556 |
| SMILES | O=C(O)c1csc(C(=O)c2cnc3ccccc23)n1 |
| InChI | InChI=1S/C13H8N2O3S/c16-11(12-15-10(6-19-12)13(17)18)8-5-14-9-4-2-1-3-7(8)9/h1-6,14H,(H,17,18) |
| InChIKey | FWXYUFQKPJMQEC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (32243812) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Indolokine A5 (CHEBI:216295) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 114826534 | ChemSpider |