EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O4 |
| Net Charge | 0 |
| Average Mass | 224.256 |
| Monoisotopic Mass | 224.10486 |
| SMILES | C/C1=C/C(=O)OCC/C(C)=C\C(=O)OCC1 |
| InChI | InChI=1S/C12H16O4/c1-9-3-5-15-12(14)8-10(2)4-6-16-11(13)7-9/h7-8H,3-6H2,1-2H3/b9-7-,10-8- |
| InChIKey | CBHNZDJUUAXCBA-XOHWUJONSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces (ncbitaxon:5094) | - | PubMed (29671776) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Talarodiolide (CHEBI:216269) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (3Z,9Z)-4,10-dimethyl-1,7-dioxacyclododeca-3,9-diene-2,8-dione |